C48H71N3O6 — CID 154040813
1-[(3,5-ditert-butyl-4-hydroxycyclohexa-2,4-dien-1-yl)methyl]-3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 154040813) has the molecular formula C48H71N3O6 and a molecular weight of 786.11 g/mol. Its IUPAC name is 1-[(3,5-ditert-butyl-4-hydroxycyclohexa-2,4-dien-1-yl)methyl]-3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[(3,5-ditert-butyl-4-hydroxycyclohexa-2,4-dien-1-yl)methyl]-3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 154040813 |
| Molecular Formula | C48H71N3O6 |
| Molecular Weight | 786.11 g/mol |
| Exact Mass | 785.53 |
| IUPAC Name | 1-[(3,5-ditert-butyl-4-hydroxycyclohexa-2,4-dien-1-yl)methyl]-3,5-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | CC(C)(C)C1=CC(Cn2c(=O)n(Cc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)c(=O)n(Cc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)c2=O)CC(C(C)(C)C)=C1O |
| InChI | InChI=1S/C48H71N3O6/c1-43(2,3)31-19-28(20-32(37(31)52)44(4,5)6)25-49-40(55)50(26-29-21-33(45(7,8)9)38(53)34(22-29)46(10,11)12)42(57)51(41(49)56)27-30-23-35(47(13,14)15)39(54)36(24-30)48(16,17)18/h19-23,30,52-54H,24-27H2,1-18H3 |
| InChIKey | PTZUUPUTRMJREK-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.11 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |