C23H31NOSi — CID 154041021
(1S)-1-[(2S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl]-2-[methyl(diphenyl)silyl]ethanol (PubChem CID 154041021) has the molecular formula C23H31NOSi and a molecular weight of 365.59 g/mol. Its IUPAC name is (1S)-1-[(2S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl]-2-[methyl(diphenyl)silyl]ethanol.
| Compound Name | (1S)-1-[(2S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl]-2-[methyl(diphenyl)silyl]ethanol |
|---|---|
| PubChem CID | 154041021 |
| Molecular Formula | C23H31NOSi |
| Molecular Weight | 365.59 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | (1S)-1-[(2S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl]-2-[methyl(diphenyl)silyl]ethanol |
| SMILES | C[Si](C[C@@H](O)[C@@H]1C[C@@H]2CCCC[C@@H]2N1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31NOSi/c1-26(19-11-4-2-5-12-19,20-13-6-3-7-14-20)17-23(25)22-16-18-10-8-9-15-21(18)24-22/h2-7,11-14,18,21-25H,8-10,15-17H2,1H3/t18-,21-,22-,23+/m0/s1 |
| InChIKey | CHKBFOYHUVWNGE-FDTGPBLFSA-N |
| XLogP | 3.16 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|