About (E)-bis(3-nitro-1,2,4-triazol-1-yl)diazene
(E)-bis(3-nitro-1,2,4-triazol-1-yl)diazene (PubChem CID 15404132) has the molecular formula C4H2N10O4
and a molecular weight of 254.13 g/mol. Its IUPAC name is (E)-bis(3-nitro-1,2,4-triazol-1-yl)diazene.
Molecular Properties
| Compound Name | (E)-bis(3-nitro-1,2,4-triazol-1-yl)diazene |
| PubChem CID | 15404132 |
| Molecular Formula | C4H2N10O4 |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | (E)-bis(3-nitro-1,2,4-triazol-1-yl)diazene |
| SMILES | O=[N+]([O-])c1ncn(/N=N/n2cnc([N+](=O)[O-])n2)n1 |
| InChI | InChI=1S/C4H2N10O4/c15-13(16)3-5-1-11(7-3)9-10-12-2-6-4(8-12)14(17)18/h1-2H/b10-9+ |
| InChIKey | SDEGKBWQNHWWLL-MDZDMXLPSA-N |
| XLogP | -0.64 |
| TPSA | 172.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-bis(3-nitro-1,2,4-triazol-1-yl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-bis(3-nitro-1,2,4-triazol-1-yl)diazene?
The IUPAC name of (E)-bis(3-nitro-1,2,4-triazol-1-yl)diazene (CID 15404132) is (E)-bis(3-nitro-1,2,4-triazol-1-yl)diazene.
What is the SMILES notation for (E)-bis(3-nitro-1,2,4-triazol-1-yl)diazene?
The canonical SMILES for (E)-bis(3-nitro-1,2,4-triazol-1-yl)diazene is O=[N+]([O-])c1ncn(/N=N/n2cnc([N+](=O)[O-])n2)n1.
What is the InChIKey of (E)-bis(3-nitro-1,2,4-triazol-1-yl)diazene?
The InChIKey is SDEGKBWQNHWWLL-MDZDMXLPSA-N. The full InChI is InChI=1S/C4H2N10O4/c15-13(16)3-5-1-11(7-3)9-10-12-2-6-4(8-12)14(17)18/h1-2H/b10-9+.
What are the key properties of (E)-bis(3-nitro-1,2,4-triazol-1-yl)diazene?
(E)-bis(3-nitro-1,2,4-triazol-1-yl)diazene has a molecular weight of 254.13 g/mol, XLogP of -0.64, 4 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-bis(3-nitro-1,2,4-triazol-1-yl)diazene is sourced from PubChem (CID 15404132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).