C15H6Cl4N2O — CID 15404251
1,2,3,4-tetrachloro-8-methylisoindolo[2,3-a]benzimidazol-11-one (PubChem CID 15404251) has the molecular formula C15H6Cl4N2O and a molecular weight of 372.04 g/mol. Its IUPAC name is 1,2,3,4-tetrachloro-8-methylisoindolo[2,3-a]benzimidazol-11-one.
| Compound Name | 1,2,3,4-tetrachloro-8-methylisoindolo[2,3-a]benzimidazol-11-one |
|---|---|
| PubChem CID | 15404251 |
| Molecular Formula | C15H6Cl4N2O |
| Molecular Weight | 372.04 g/mol |
| Exact Mass | 369.92 |
| IUPAC Name | 1,2,3,4-tetrachloro-8-methylisoindolo[2,3-a]benzimidazol-11-one |
| SMILES | Cc1ccc2nc3n(c2c1)C(=O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1-3 |
| InChI | InChI=1S/C15H6Cl4N2O/c1-5-2-3-6-7(4-5)21-14(20-6)8-9(15(21)22)11(17)13(19)12(18)10(8)16/h2-4H,1H3 |
| InChIKey | FBSHSWWOCHVEJN-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.04 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|