About 2,4-diamino-5-hydroxyimino-1,2-dihydropyrimidin-6-one
2,4-diamino-5-hydroxyimino-1,2-dihydropyrimidin-6-one (PubChem CID 154042915) has the molecular formula C4H7N5O2
and a molecular weight of 157.13 g/mol. Its IUPAC name is 2,4-diamino-5-hydroxyimino-1,2-dihydropyrimidin-6-one.
Molecular Properties
| Compound Name | 2,4-diamino-5-hydroxyimino-1,2-dihydropyrimidin-6-one |
| PubChem CID | 154042915 |
| Molecular Formula | C4H7N5O2 |
| Molecular Weight | 157.13 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 2,4-diamino-5-hydroxyimino-1,2-dihydropyrimidin-6-one |
| SMILES | NC1=NC(N)NC(=O)C1=NO |
| InChI | InChI=1S/C4H7N5O2/c5-2-1(9-11)3(10)8-4(6)7-2/h4,11H,6H2,(H2,5,7)(H,8,10) |
| InChIKey | XUKSDXONPISDKD-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 126.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.13 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diamino-5-hydroxyimino-1,2-dihydropyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diamino-5-hydroxyimino-1,2-dihydropyrimidin-6-one?
The IUPAC name of 2,4-diamino-5-hydroxyimino-1,2-dihydropyrimidin-6-one (CID 154042915) is 2,4-diamino-5-hydroxyimino-1,2-dihydropyrimidin-6-one.
What is the SMILES notation for 2,4-diamino-5-hydroxyimino-1,2-dihydropyrimidin-6-one?
The canonical SMILES for 2,4-diamino-5-hydroxyimino-1,2-dihydropyrimidin-6-one is NC1=NC(N)NC(=O)C1=NO.
What is the InChIKey of 2,4-diamino-5-hydroxyimino-1,2-dihydropyrimidin-6-one?
The InChIKey is XUKSDXONPISDKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N5O2/c5-2-1(9-11)3(10)8-4(6)7-2/h4,11H,6H2,(H2,5,7)(H,8,10).
What are the key properties of 2,4-diamino-5-hydroxyimino-1,2-dihydropyrimidin-6-one?
2,4-diamino-5-hydroxyimino-1,2-dihydropyrimidin-6-one has a molecular weight of 157.13 g/mol, XLogP of -2.45, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diamino-5-hydroxyimino-1,2-dihydropyrimidin-6-one is sourced from PubChem (CID 154042915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).