About 8-amino-5-[(2,4-dimethyl-6-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid
8-amino-5-[(2,4-dimethyl-6-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid (PubChem CID 15404373) has the molecular formula C18H17N3O6S2
and a molecular weight of 435.48 g/mol. Its IUPAC name is 8-amino-5-[(2,4-dimethyl-6-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid.
Molecular Properties
| Compound Name | 8-amino-5-[(2,4-dimethyl-6-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
| PubChem CID | 15404373 |
| Molecular Formula | C18H17N3O6S2 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 8-amino-5-[(2,4-dimethyl-6-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid |
| SMILES | Cc1cc(C)c(/N=N/c2ccc(N)c3cc(S(=O)(=O)O)ccc23)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C18H17N3O6S2/c1-10-7-11(2)18(17(8-10)29(25,26)27)21-20-16-6-5-15(19)14-9-12(28(22,23)24)3-4-13(14)16/h3-9H,19H2,1-2H3,(H,22,23,24)(H,25,26,27)/b21-20+ |
| InChIKey | XODGPXLPWLFEGU-QZQOTICOSA-N |
| XLogP | 3.95 |
| TPSA | 159.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 8-amino-5-[(2,4-dimethyl-6-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-5-[(2,4-dimethyl-6-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid?
The IUPAC name of 8-amino-5-[(2,4-dimethyl-6-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid (CID 15404373) is 8-amino-5-[(2,4-dimethyl-6-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid.
What is the SMILES notation for 8-amino-5-[(2,4-dimethyl-6-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid?
The canonical SMILES for 8-amino-5-[(2,4-dimethyl-6-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid is Cc1cc(C)c(/N=N/c2ccc(N)c3cc(S(=O)(=O)O)ccc23)c(S(=O)(=O)O)c1.
What is the InChIKey of 8-amino-5-[(2,4-dimethyl-6-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid?
The InChIKey is XODGPXLPWLFEGU-QZQOTICOSA-N. The full InChI is InChI=1S/C18H17N3O6S2/c1-10-7-11(2)18(17(8-10)29(25,26)27)21-20-16-6-5-15(19)14-9-12(28(22,23)24)3-4-13(14)16/h3-9H,19H2,1-2H3,(H,22,23,24)(H,25,26,27)/b21-20+.
What are the key properties of 8-amino-5-[(2,4-dimethyl-6-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid?
8-amino-5-[(2,4-dimethyl-6-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid has a molecular weight of 435.48 g/mol, XLogP of 3.95, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-5-[(2,4-dimethyl-6-sulfophenyl)diazenyl]naphthalene-2-sulfonic acid is sourced from PubChem (CID 15404373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).