C32H32F4N6O2S — CID 154046381
1-[3-(4-fluoro-2-propan-2-ylphenyl)-1,3-thiazinan-2-ylidene]-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea (PubChem CID 154046381) has the molecular formula C32H32F4N6O2S and a molecular weight of 640.71 g/mol. Its IUPAC name is 1-[3-(4-fluoro-2-propan-2-ylphenyl)-1,3-thiazinan-2-ylidene]-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea.
| Compound Name | 1-[3-(4-fluoro-2-propan-2-ylphenyl)-1,3-thiazinan-2-ylidene]-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea |
|---|---|
| PubChem CID | 154046381 |
| Molecular Formula | C32H32F4N6O2S |
| Molecular Weight | 640.71 g/mol |
| Exact Mass | 640.22 |
| IUPAC Name | 1-[3-(4-fluoro-2-propan-2-ylphenyl)-1,3-thiazinan-2-ylidene]-3-[3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]propyl]urea |
| SMILES | CC(C)c1cc(F)ccc1N1CCCSC1=NC(=O)NCCCc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C32H32F4N6O2S/c1-21(2)27-19-24(33)10-15-28(27)41-17-4-18-45-31(41)39-30(43)37-16-3-5-22-6-8-23(9-7-22)29-38-20-42(40-29)25-11-13-26(14-12-25)44-32(34,35)36/h6-15,19-21H,3-5,16-18H2,1-2H3,(H,37,43) |
| InChIKey | ISDPKBXKZUTBCR-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.71 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|