C16H18N4O6 — CID 154047073
N-[1-[(2R,3S,4S,5R)-4-amino-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 154047073) has the molecular formula C16H18N4O6 and a molecular weight of 362.34 g/mol. Its IUPAC name is N-[1-[(2R,3S,4S,5R)-4-amino-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(2R,3S,4S,5R)-4-amino-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 154047073 |
| Molecular Formula | C16H18N4O6 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-[1-[(2R,3S,4S,5R)-4-amino-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | N[C@@]1(O)[C@@H](CO)O[C@@H](n2ccc(NC(=O)c3ccccc3)nc2=O)[C@@H]1O |
| InChI | InChI=1S/C16H18N4O6/c17-16(25)10(8-21)26-14(12(16)22)20-7-6-11(19-15(20)24)18-13(23)9-4-2-1-3-5-9/h1-7,10,12,14,21-22,25H,8,17H2,(H,18,19,23,24)/t10-,12+,14-,16-/m1/s1 |
| InChIKey | RFOPBBVERMWYNI-HTWGDNNSSA-N |
| XLogP | -1.61 |
| TPSA | 159.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|