About N,N'-bis(trimethylsilyloxy)butane-1,4-diimine
N,N'-bis(trimethylsilyloxy)butane-1,4-diimine (PubChem CID 154048225) has the molecular formula C10H24N2O2Si2
and a molecular weight of 260.49 g/mol. Its IUPAC name is N,N'-bis(trimethylsilyloxy)butane-1,4-diimine.
Molecular Properties
| Compound Name | N,N'-bis(trimethylsilyloxy)butane-1,4-diimine |
|---|
| PubChem CID | 154048225 |
|---|
| Molecular Formula | C10H24N2O2Si2 |
|---|
| Molecular Weight | 260.49 g/mol |
|---|
| Exact Mass | 260.14 |
|---|
| IUPAC Name | N,N'-bis(trimethylsilyloxy)butane-1,4-diimine |
|---|
| SMILES | C[Si](C)(C)ON=CCCC=NO[Si](C)(C)C |
|---|
| InChI | InChI=1S/C10H24N2O2Si2/c1-15(2,3)13-11-9-7-8-10-12-14-16(4,5)6/h9-10H,7-8H2,1-6H3 |
|---|
| InChIKey | JPBIWPXRFUPWQU-UHFFFAOYSA-N |
|---|
| XLogP | 3.44 |
|---|
| TPSA | 43.18 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 4 |
|---|
| Rotatable Bonds | 7 |
|---|
| Heavy Atoms | 16 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 260.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(trimethylsilyloxy)butane-1,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(trimethylsilyloxy)butane-1,4-diimine?
The IUPAC name of N,N'-bis(trimethylsilyloxy)butane-1,4-diimine (CID 154048225) is N,N'-bis(trimethylsilyloxy)butane-1,4-diimine.
What is the SMILES notation for N,N'-bis(trimethylsilyloxy)butane-1,4-diimine?
The canonical SMILES for N,N'-bis(trimethylsilyloxy)butane-1,4-diimine is C[Si](C)(C)ON=CCCC=NO[Si](C)(C)C.
What is the InChIKey of N,N'-bis(trimethylsilyloxy)butane-1,4-diimine?
The InChIKey is JPBIWPXRFUPWQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2O2Si2/c1-15(2,3)13-11-9-7-8-10-12-14-16(4,5)6/h9-10H,7-8H2,1-6H3.
What are the key properties of N,N'-bis(trimethylsilyloxy)butane-1,4-diimine?
N,N'-bis(trimethylsilyloxy)butane-1,4-diimine has a molecular weight of 260.49 g/mol, XLogP of 3.44, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(trimethylsilyloxy)butane-1,4-diimine is sourced from PubChem (CID 154048225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).