About (diphenyl-λ3-iodanyl) 9,10-dimethoxyanthracene-2-sulfonate
(diphenyl-λ3-iodanyl) 9,10-dimethoxyanthracene-2-sulfonate (PubChem CID 15404962) has the molecular formula C28H23IO5S
and a molecular weight of 598.46 g/mol. Its IUPAC name is (diphenyl-λ3-iodanyl) 9,10-dimethoxyanthracene-2-sulfonate.
Molecular Properties
| Compound Name | (diphenyl-λ3-iodanyl) 9,10-dimethoxyanthracene-2-sulfonate |
| PubChem CID | 15404962 |
| Molecular Formula | C28H23IO5S |
| Molecular Weight | 598.46 g/mol |
| Exact Mass | 598.03 |
| IUPAC Name | (diphenyl-λ3-iodanyl) 9,10-dimethoxyanthracene-2-sulfonate |
| SMILES | COc1c2ccccc2c(OC)c2cc(S(=O)(=O)OI(c3ccccc3)c3ccccc3)ccc12 |
| InChI | InChI=1S/C28H23IO5S/c1-32-27-23-15-9-10-16-24(23)28(33-2)26-19-22(17-18-25(26)27)35(30,31)34-29(20-11-5-3-6-12-20)21-13-7-4-8-14-21/h3-19H,1-2H3 |
| InChIKey | BTBKFHGILAAGKX-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 598.46 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze (diphenyl-λ3-iodanyl) 9,10-dimethoxyanthracene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (diphenyl-λ3-iodanyl) 9,10-dimethoxyanthracene-2-sulfonate?
The IUPAC name of (diphenyl-λ3-iodanyl) 9,10-dimethoxyanthracene-2-sulfonate (CID 15404962) is (diphenyl-λ3-iodanyl) 9,10-dimethoxyanthracene-2-sulfonate.
What is the SMILES notation for (diphenyl-λ3-iodanyl) 9,10-dimethoxyanthracene-2-sulfonate?
The canonical SMILES for (diphenyl-λ3-iodanyl) 9,10-dimethoxyanthracene-2-sulfonate is COc1c2ccccc2c(OC)c2cc(S(=O)(=O)OI(c3ccccc3)c3ccccc3)ccc12.
What is the InChIKey of (diphenyl-λ3-iodanyl) 9,10-dimethoxyanthracene-2-sulfonate?
The InChIKey is BTBKFHGILAAGKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H23IO5S/c1-32-27-23-15-9-10-16-24(23)28(33-2)26-19-22(17-18-25(26)27)35(30,31)34-29(20-11-5-3-6-12-20)21-13-7-4-8-14-21/h3-19H,1-2H3.
What are the key properties of (diphenyl-λ3-iodanyl) 9,10-dimethoxyanthracene-2-sulfonate?
(diphenyl-λ3-iodanyl) 9,10-dimethoxyanthracene-2-sulfonate has a molecular weight of 598.46 g/mol, XLogP of 6.88, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (diphenyl-λ3-iodanyl) 9,10-dimethoxyanthracene-2-sulfonate is sourced from PubChem (CID 15404962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).