C25H28F2N2O3 — CID 154050205
(2R)-2-(1-benzofuran-6-yl)-5,5-difluoro-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid (PubChem CID 154050205) has the molecular formula C25H28F2N2O3 and a molecular weight of 442.51 g/mol. Its IUPAC name is (2R)-2-(1-benzofuran-6-yl)-5,5-difluoro-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid.
| Compound Name | (2R)-2-(1-benzofuran-6-yl)-5,5-difluoro-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 154050205 |
| Molecular Formula | C25H28F2N2O3 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | (2R)-2-(1-benzofuran-6-yl)-5,5-difluoro-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| SMILES | O=C(O)[C@H](CCC(F)(F)CCCCc1ccc2c(n1)NCCC2)c1ccc2ccoc2c1 |
| InChI | InChI=1S/C25H28F2N2O3/c26-25(27,12-2-1-5-20-9-8-18-4-3-14-28-23(18)29-20)13-10-21(24(30)31)19-7-6-17-11-15-32-22(17)16-19/h6-9,11,15-16,21H,1-5,10,12-14H2,(H,28,29)(H,30,31)/t21-/m1/s1 |
| InChIKey | ZDEIFPXDYFRAGO-OAQYLSRUSA-N |
| XLogP | 6.18 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|