C29H23ClFN7O — CID 154052725
N-[N'-[4-[[9-chloro-7-(2-fluorophenyl)-5H-pyrimido[5,4-i][2]benzazepin-2-yl]amino]phenyl]carbamimidoyl]cyclopropanecarboxamide (PubChem CID 154052725) has the molecular formula C29H23ClFN7O and a molecular weight of 540.00 g/mol. Its IUPAC name is N-[N'-[4-[[9-chloro-7-(2-fluorophenyl)-5H-pyrimido[5,4-i][2]benzazepin-2-yl]amino]phenyl]carbamimidoyl]cyclopropanecarboxamide.
| Compound Name | N-[N'-[4-[[9-chloro-7-(2-fluorophenyl)-5H-pyrimido[5,4-i][2]benzazepin-2-yl]amino]phenyl]carbamimidoyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 154052725 |
| Molecular Formula | C29H23ClFN7O |
| Molecular Weight | 540.00 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | N-[N'-[4-[[9-chloro-7-(2-fluorophenyl)-5H-pyrimido[5,4-i][2]benzazepin-2-yl]amino]phenyl]carbamimidoyl]cyclopropanecarboxamide |
| SMILES | N/C(=N\c1ccc(Nc2ncc3c(n2)C2=CN=C(Cl)C=C(c4ccccc4F)C2=CC3)cc1)NC(=O)C1CC1 |
| InChI | InChI=1S/C29H23ClFN7O/c30-25-13-22(21-3-1-2-4-24(21)31)20-12-7-17-14-34-29(37-26(17)23(20)15-33-25)36-19-10-8-18(9-11-19)35-28(32)38-27(39)16-5-6-16/h1-4,8-16H,5-7H2,(H,34,36,37)(H3,32,35,38,39) |
| InChIKey | NWYUDPWNOMGARX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 117.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.00 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|