About 2-[6,7-difluoro-5-[(3-propyloxiran-2-yl)methoxy]naphthalen-2-yl]-5-hexoxypyrimidine
2-[6,7-difluoro-5-[(3-propyloxiran-2-yl)methoxy]naphthalen-2-yl]-5-hexoxypyrimidine (PubChem CID 15405320) has the molecular formula C26H30F2N2O3
and a molecular weight of 456.53 g/mol. Its IUPAC name is 2-[6,7-difluoro-5-[(3-propyloxiran-2-yl)methoxy]naphthalen-2-yl]-5-hexoxypyrimidine.
Molecular Properties
| Compound Name | 2-[6,7-difluoro-5-[(3-propyloxiran-2-yl)methoxy]naphthalen-2-yl]-5-hexoxypyrimidine |
| PubChem CID | 15405320 |
| Molecular Formula | C26H30F2N2O3 |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 2-[6,7-difluoro-5-[(3-propyloxiran-2-yl)methoxy]naphthalen-2-yl]-5-hexoxypyrimidine |
| SMILES | CCCCCCOc1cnc(-c2ccc3c(OCC4OC4CCC)c(F)c(F)cc3c2)nc1 |
| InChI | InChI=1S/C26H30F2N2O3/c1-3-5-6-7-11-31-19-14-29-26(30-15-19)17-9-10-20-18(12-17)13-21(27)24(28)25(20)32-16-23-22(33-23)8-4-2/h9-10,12-15,22-23H,3-8,11,16H2,1-2H3 |
| InChIKey | WJPNTCSSZUCNGV-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 56.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[6,7-difluoro-5-[(3-propyloxiran-2-yl)methoxy]naphthalen-2-yl]-5-hexoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6,7-difluoro-5-[(3-propyloxiran-2-yl)methoxy]naphthalen-2-yl]-5-hexoxypyrimidine?
The IUPAC name of 2-[6,7-difluoro-5-[(3-propyloxiran-2-yl)methoxy]naphthalen-2-yl]-5-hexoxypyrimidine (CID 15405320) is 2-[6,7-difluoro-5-[(3-propyloxiran-2-yl)methoxy]naphthalen-2-yl]-5-hexoxypyrimidine.
What is the SMILES notation for 2-[6,7-difluoro-5-[(3-propyloxiran-2-yl)methoxy]naphthalen-2-yl]-5-hexoxypyrimidine?
The canonical SMILES for 2-[6,7-difluoro-5-[(3-propyloxiran-2-yl)methoxy]naphthalen-2-yl]-5-hexoxypyrimidine is CCCCCCOc1cnc(-c2ccc3c(OCC4OC4CCC)c(F)c(F)cc3c2)nc1.
What is the InChIKey of 2-[6,7-difluoro-5-[(3-propyloxiran-2-yl)methoxy]naphthalen-2-yl]-5-hexoxypyrimidine?
The InChIKey is WJPNTCSSZUCNGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30F2N2O3/c1-3-5-6-7-11-31-19-14-29-26(30-15-19)17-9-10-20-18(12-17)13-21(27)24(28)25(20)32-16-23-22(33-23)8-4-2/h9-10,12-15,22-23H,3-8,11,16H2,1-2H3.
What are the key properties of 2-[6,7-difluoro-5-[(3-propyloxiran-2-yl)methoxy]naphthalen-2-yl]-5-hexoxypyrimidine?
2-[6,7-difluoro-5-[(3-propyloxiran-2-yl)methoxy]naphthalen-2-yl]-5-hexoxypyrimidine has a molecular weight of 456.53 g/mol, XLogP of 6.48, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6,7-difluoro-5-[(3-propyloxiran-2-yl)methoxy]naphthalen-2-yl]-5-hexoxypyrimidine is sourced from PubChem (CID 15405320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).