C9H6F2N2O2S2 — CID 15405413
2-(2,6-difluorophenyl)-5-methylsulfonyl-1,3,4-thiadiazole (PubChem CID 15405413) has the molecular formula C9H6F2N2O2S2 and a molecular weight of 276.29 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-5-methylsulfonyl-1,3,4-thiadiazole.
| Compound Name | 2-(2,6-difluorophenyl)-5-methylsulfonyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 15405413 |
| Molecular Formula | C9H6F2N2O2S2 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | 2-(2,6-difluorophenyl)-5-methylsulfonyl-1,3,4-thiadiazole |
| SMILES | CS(=O)(=O)c1nnc(-c2c(F)cccc2F)s1 |
| InChI | InChI=1S/C9H6F2N2O2S2/c1-17(14,15)9-13-12-8(16-9)7-5(10)3-2-4-6(7)11/h2-4H,1H3 |
| InChIKey | GZCSVDYWPQBJCC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |