C30H30N4O4 — CID 154055130
5-cyclobutyl-3-[2-hydroxy-5-[(2-methoxybenzoyl)amino]phenyl]-N-(2-phenylethyl)pyrazole-1-carboxamide (PubChem CID 154055130) has the molecular formula C30H30N4O4 and a molecular weight of 510.59 g/mol. Its IUPAC name is 5-cyclobutyl-3-[2-hydroxy-5-[(2-methoxybenzoyl)amino]phenyl]-N-(2-phenylethyl)pyrazole-1-carboxamide.
| Compound Name | 5-cyclobutyl-3-[2-hydroxy-5-[(2-methoxybenzoyl)amino]phenyl]-N-(2-phenylethyl)pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 154055130 |
| Molecular Formula | C30H30N4O4 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 5-cyclobutyl-3-[2-hydroxy-5-[(2-methoxybenzoyl)amino]phenyl]-N-(2-phenylethyl)pyrazole-1-carboxamide |
| SMILES | COc1ccccc1C(=O)Nc1ccc(O)c(-c2cc(C3CCC3)n(C(=O)NCCc3ccccc3)n2)c1 |
| InChI | InChI=1S/C30H30N4O4/c1-38-28-13-6-5-12-23(28)29(36)32-22-14-15-27(35)24(18-22)25-19-26(21-10-7-11-21)34(33-25)30(37)31-17-16-20-8-3-2-4-9-20/h2-6,8-9,12-15,18-19,21,35H,7,10-11,16-17H2,1H3,(H,31,37)(H,32,36) |
| InChIKey | YBHAEOBJXGONOU-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|