About 2-methyl-4-(1-methyl-2,3-dihydrotetrazol-5-yl)-1H-pyrazole-3-thione
2-methyl-4-(1-methyl-2,3-dihydrotetrazol-5-yl)-1H-pyrazole-3-thione (PubChem CID 154056827) has the molecular formula C6H10N6S
and a molecular weight of 198.25 g/mol. Its IUPAC name is 2-methyl-4-(1-methyl-2,3-dihydrotetrazol-5-yl)-1H-pyrazole-3-thione.
Molecular Properties
| Compound Name | 2-methyl-4-(1-methyl-2,3-dihydrotetrazol-5-yl)-1H-pyrazole-3-thione |
| PubChem CID | 154056827 |
| Molecular Formula | C6H10N6S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 2-methyl-4-(1-methyl-2,3-dihydrotetrazol-5-yl)-1H-pyrazole-3-thione |
| SMILES | CN1NNN=C1c1c[nH]n(C)c1=S |
| InChI | InChI=1S/C6H10N6S/c1-11-5(8-9-10-11)4-3-7-12(2)6(4)13/h3,7,9-10H,1-2H3 |
| InChIKey | QZKMRNMRYOABJC-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 60.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-(1-methyl-2,3-dihydrotetrazol-5-yl)-1H-pyrazole-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(1-methyl-2,3-dihydrotetrazol-5-yl)-1H-pyrazole-3-thione?
The IUPAC name of 2-methyl-4-(1-methyl-2,3-dihydrotetrazol-5-yl)-1H-pyrazole-3-thione (CID 154056827) is 2-methyl-4-(1-methyl-2,3-dihydrotetrazol-5-yl)-1H-pyrazole-3-thione.
What is the SMILES notation for 2-methyl-4-(1-methyl-2,3-dihydrotetrazol-5-yl)-1H-pyrazole-3-thione?
The canonical SMILES for 2-methyl-4-(1-methyl-2,3-dihydrotetrazol-5-yl)-1H-pyrazole-3-thione is CN1NNN=C1c1c[nH]n(C)c1=S.
What is the InChIKey of 2-methyl-4-(1-methyl-2,3-dihydrotetrazol-5-yl)-1H-pyrazole-3-thione?
The InChIKey is QZKMRNMRYOABJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N6S/c1-11-5(8-9-10-11)4-3-7-12(2)6(4)13/h3,7,9-10H,1-2H3.
What are the key properties of 2-methyl-4-(1-methyl-2,3-dihydrotetrazol-5-yl)-1H-pyrazole-3-thione?
2-methyl-4-(1-methyl-2,3-dihydrotetrazol-5-yl)-1H-pyrazole-3-thione has a molecular weight of 198.25 g/mol, XLogP of -0.30, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(1-methyl-2,3-dihydrotetrazol-5-yl)-1H-pyrazole-3-thione is sourced from PubChem (CID 154056827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).