About nonan-3-yl 7-acetamidoheptanoate
nonan-3-yl 7-acetamidoheptanoate (PubChem CID 154056930) has the molecular formula C18H35NO3
and a molecular weight of 313.48 g/mol. Its IUPAC name is nonan-3-yl 7-acetamidoheptanoate.
Molecular Properties
| Compound Name | nonan-3-yl 7-acetamidoheptanoate |
| PubChem CID | 154056930 |
| Molecular Formula | C18H35NO3 |
| Molecular Weight | 313.48 g/mol |
| Exact Mass | 313.26 |
| IUPAC Name | nonan-3-yl 7-acetamidoheptanoate |
| SMILES | CCCCCCC(CC)OC(=O)CCCCCCNC(C)=O |
| InChI | InChI=1S/C18H35NO3/c1-4-6-7-10-13-17(5-2)22-18(21)14-11-8-9-12-15-19-16(3)20/h17H,4-15H2,1-3H3,(H,19,20) |
| InChIKey | ROQQKMINCDDNEG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze nonan-3-yl 7-acetamidoheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonan-3-yl 7-acetamidoheptanoate?
The IUPAC name of nonan-3-yl 7-acetamidoheptanoate (CID 154056930) is nonan-3-yl 7-acetamidoheptanoate.
What is the SMILES notation for nonan-3-yl 7-acetamidoheptanoate?
The canonical SMILES for nonan-3-yl 7-acetamidoheptanoate is CCCCCCC(CC)OC(=O)CCCCCCNC(C)=O.
What is the InChIKey of nonan-3-yl 7-acetamidoheptanoate?
The InChIKey is ROQQKMINCDDNEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35NO3/c1-4-6-7-10-13-17(5-2)22-18(21)14-11-8-9-12-15-19-16(3)20/h17H,4-15H2,1-3H3,(H,19,20).
What are the key properties of nonan-3-yl 7-acetamidoheptanoate?
nonan-3-yl 7-acetamidoheptanoate has a molecular weight of 313.48 g/mol, XLogP of 4.37, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for nonan-3-yl 7-acetamidoheptanoate is sourced from PubChem (CID 154056930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).