C32H27NO3 — CID 154057756
benzyl 4-anthracen-9-yl-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 154057756) has the molecular formula C32H27NO3 and a molecular weight of 473.57 g/mol. Its IUPAC name is benzyl 4-anthracen-9-yl-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | benzyl 4-anthracen-9-yl-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 154057756 |
| Molecular Formula | C32H27NO3 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | benzyl 4-anthracen-9-yl-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CC1=C(C(=O)OCc2ccccc2)C(c2c3ccccc3cc3ccccc23)C2=C(CCCC2=O)N1 |
| InChI | InChI=1S/C32H27NO3/c1-20-28(32(35)36-19-21-10-3-2-4-11-21)31(30-26(33-20)16-9-17-27(30)34)29-24-14-7-5-12-22(24)18-23-13-6-8-15-25(23)29/h2-8,10-15,18,31,33H,9,16-17,19H2,1H3 |
| InChIKey | QKJBRQFFKWSWGD-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|