C17H14N4O2S — CID 154057779
6-amino-3-(2,5-dimethylthiophen-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazole-5-carboxamide (PubChem CID 154057779) has the molecular formula C17H14N4O2S and a molecular weight of 338.39 g/mol. Its IUPAC name is 6-amino-3-(2,5-dimethylthiophen-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazole-5-carboxamide.
| Compound Name | 6-amino-3-(2,5-dimethylthiophen-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 154057779 |
| Molecular Formula | C17H14N4O2S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 6-amino-3-(2,5-dimethylthiophen-3-yl)-4-oxo-1H-indeno[2,1-d]pyrazole-5-carboxamide |
| SMILES | Cc1cc(-c2n[nH]c3c2C(=O)c2c-3ccc(N)c2C(N)=O)c(C)s1 |
| InChI | InChI=1S/C17H14N4O2S/c1-6-5-9(7(2)24-6)15-13-14(20-21-15)8-3-4-10(18)12(17(19)23)11(8)16(13)22/h3-5H,18H2,1-2H3,(H2,19,23)(H,20,21) |
| InChIKey | PHPXPFSPRXLGRU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 114.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|