C16H24O5 — CID 15405871
[(1S,3aR,8aR)-3a-(2-hydroxypropan-2-yl)-1-methyl-4,8-dioxo-2,3,5,6,7,8a-hexahydroazulen-1-yl] acetate (PubChem CID 15405871) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is [(1S,3aR,8aR)-3a-(2-hydroxypropan-2-yl)-1-methyl-4,8-dioxo-2,3,5,6,7,8a-hexahydroazulen-1-yl] acetate.
| Compound Name | [(1S,3aR,8aR)-3a-(2-hydroxypropan-2-yl)-1-methyl-4,8-dioxo-2,3,5,6,7,8a-hexahydroazulen-1-yl] acetate |
|---|---|
| PubChem CID | 15405871 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | [(1S,3aR,8aR)-3a-(2-hydroxypropan-2-yl)-1-methyl-4,8-dioxo-2,3,5,6,7,8a-hexahydroazulen-1-yl] acetate |
| SMILES | CC(=O)O[C@@]1(C)CC[C@@]2(C(C)(C)O)C(=O)CCCC(=O)[C@@H]12 |
| InChI | InChI=1S/C16H24O5/c1-10(17)21-15(4)8-9-16(14(2,3)20)12(19)7-5-6-11(18)13(15)16/h13,20H,5-9H2,1-4H3/t13-,15-,16+/m0/s1 |
| InChIKey | ZXUSVOKNKCQGIH-CWRNSKLLSA-N |
| XLogP | 1.80 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |