C40H86O3Si3Sn — CID 154059646
[(1S)-1-[(1S,3S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-3-methyl-5-tributylstannylpenta-2,4-dienoxy]-tert-butyl-dimethylsilane (PubChem CID 154059646) has the molecular formula C40H86O3Si3Sn and a molecular weight of 818.09 g/mol. Its IUPAC name is [(1S)-1-[(1S,3S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-3-methyl-5-tributylstannylpenta-2,4-dienoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1S)-1-[(1S,3S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-3-methyl-5-tributylstannylpenta-2,4-dienoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 154059646 |
| Molecular Formula | C40H86O3Si3Sn |
| Molecular Weight | 818.09 g/mol |
| Exact Mass | 818.49 |
| IUPAC Name | [(1S)-1-[(1S,3S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]butyl]-3-methyl-5-tributylstannylpenta-2,4-dienoxy]-tert-butyl-dimethylsilane |
| SMILES | CCCC[Sn](C=CC(C)=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C[C@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C28H59O3Si3.3C4H9.Sn/c1-19-22(2)20-24(30-33(15,16)27(7,8)9)25(31-34(17,18)28(10,11)12)21-23(3)29-32(13,14)26(4,5)6;3*1-3-4-2;/h1,19-20,23-25H,21H2,2-18H3;3*1,3-4H2,2H3;/t23-,24-,25-;;;;/m0..../s1 |
| InChIKey | LSBKZWWBVIHOTL-FSPKASDCSA-N |
| XLogP | 14.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.09 |
| LogP ≤ 5 | 14.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|