C19H26O2 — CID 154061007
(8S,13R,14S)-13-(methoxymethyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 154061007) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is (8S,13R,14S)-13-(methoxymethyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,13R,14S)-13-(methoxymethyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 154061007 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (8S,13R,14S)-13-(methoxymethyl)-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | COC[C@@]12CCC[C@H]1[C@@H]1CCC3=CC(=O)CCC3=C1CC2 |
| InChI | InChI=1S/C19H26O2/c1-21-12-19-9-2-3-18(19)17-6-4-13-11-14(20)5-7-15(13)16(17)8-10-19/h11,17-18H,2-10,12H2,1H3/t17-,18+,19+/m1/s1 |
| InChIKey | PRPIRDRPKVUHCC-QYZOEREBSA-N |
| XLogP | 4.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |