About 5-[(1-methylpyrrol-3-yl)methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one
5-[(1-methylpyrrol-3-yl)methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one (PubChem CID 154061590) has the molecular formula C9H8N2O2S
and a molecular weight of 208.24 g/mol. Its IUPAC name is 5-[(1-methylpyrrol-3-yl)methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one.
Molecular Properties
| Compound Name | 5-[(1-methylpyrrol-3-yl)methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one |
| PubChem CID | 154061590 |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 5-[(1-methylpyrrol-3-yl)methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one |
| SMILES | Cn1ccc(C=C2OC(=S)NC2=O)c1 |
| InChI | InChI=1S/C9H8N2O2S/c1-11-3-2-6(5-11)4-7-8(12)10-9(14)13-7/h2-5H,1H3,(H,10,12,14) |
| InChIKey | KHBQYUCBFXQYFU-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1-methylpyrrol-3-yl)methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1-methylpyrrol-3-yl)methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one?
The IUPAC name of 5-[(1-methylpyrrol-3-yl)methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one (CID 154061590) is 5-[(1-methylpyrrol-3-yl)methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one.
What is the SMILES notation for 5-[(1-methylpyrrol-3-yl)methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one?
The canonical SMILES for 5-[(1-methylpyrrol-3-yl)methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one is Cn1ccc(C=C2OC(=S)NC2=O)c1.
What is the InChIKey of 5-[(1-methylpyrrol-3-yl)methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one?
The InChIKey is KHBQYUCBFXQYFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2S/c1-11-3-2-6(5-11)4-7-8(12)10-9(14)13-7/h2-5H,1H3,(H,10,12,14).
What are the key properties of 5-[(1-methylpyrrol-3-yl)methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one?
5-[(1-methylpyrrol-3-yl)methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one has a molecular weight of 208.24 g/mol, XLogP of 0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1-methylpyrrol-3-yl)methylidene]-2-sulfanylidene-1,3-oxazolidin-4-one is sourced from PubChem (CID 154061590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).