About spiro[1H-2-benzofuran-3,5'-bicyclo[2.2.2]octane]-2'-ol
spiro[1H-2-benzofuran-3,5'-bicyclo[2.2.2]octane]-2'-ol (PubChem CID 154062038) has the molecular formula C15H18O2
and a molecular weight of 230.31 g/mol. Its IUPAC name is spiro[1H-2-benzofuran-3,5'-bicyclo[2.2.2]octane]-2'-ol.
Molecular Properties
| Compound Name | spiro[1H-2-benzofuran-3,5'-bicyclo[2.2.2]octane]-2'-ol |
| PubChem CID | 154062038 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | spiro[1H-2-benzofuran-3,5'-bicyclo[2.2.2]octane]-2'-ol |
| SMILES | OC1CC2CCC1CC21OCc2ccccc21 |
| InChI | InChI=1S/C15H18O2/c16-14-7-12-6-5-10(14)8-15(12)13-4-2-1-3-11(13)9-17-15/h1-4,10,12,14,16H,5-9H2 |
| InChIKey | WDWCTJRYVSCSDQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[1H-2-benzofuran-3,5'-bicyclo[2.2.2]octane]-2'-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1H-2-benzofuran-3,5'-bicyclo[2.2.2]octane]-2'-ol?
The IUPAC name of spiro[1H-2-benzofuran-3,5'-bicyclo[2.2.2]octane]-2'-ol (CID 154062038) is spiro[1H-2-benzofuran-3,5'-bicyclo[2.2.2]octane]-2'-ol.
What is the SMILES notation for spiro[1H-2-benzofuran-3,5'-bicyclo[2.2.2]octane]-2'-ol?
The canonical SMILES for spiro[1H-2-benzofuran-3,5'-bicyclo[2.2.2]octane]-2'-ol is OC1CC2CCC1CC21OCc2ccccc21.
What is the InChIKey of spiro[1H-2-benzofuran-3,5'-bicyclo[2.2.2]octane]-2'-ol?
The InChIKey is WDWCTJRYVSCSDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O2/c16-14-7-12-6-5-10(14)8-15(12)13-4-2-1-3-11(13)9-17-15/h1-4,10,12,14,16H,5-9H2.
What are the key properties of spiro[1H-2-benzofuran-3,5'-bicyclo[2.2.2]octane]-2'-ol?
spiro[1H-2-benzofuran-3,5'-bicyclo[2.2.2]octane]-2'-ol has a molecular weight of 230.31 g/mol, XLogP of 2.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1H-2-benzofuran-3,5'-bicyclo[2.2.2]octane]-2'-ol is sourced from PubChem (CID 154062038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).