C15H18O2 — CID 154062038
spiro[1H-2-benzofuran-3,5'-bicyclo[2.2.2]octane]-2'-ol (PubChem CID 154062038) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is spiro[1H-2-benzofuran-3,5'-bicyclo[2.2.2]octane]-2'-ol.
| Compound Name | spiro[1H-2-benzofuran-3,5'-bicyclo[2.2.2]octane]-2'-ol |
|---|---|
| PubChem CID | 154062038 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | spiro[1H-2-benzofuran-3,5'-bicyclo[2.2.2]octane]-2'-ol |
| SMILES | OC1CC2CCC1CC21OCc2ccccc21 |
| InChI | InChI=1S/C15H18O2/c16-14-7-12-6-5-10(14)8-15(12)13-4-2-1-3-11(13)9-17-15/h1-4,10,12,14,16H,5-9H2 |
| InChIKey | WDWCTJRYVSCSDQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |