C29H26FN7O2S — CID 154062280
5-[[2-[4-[[(5-fluoro-2-isoquinolin-4-yl-4-pyridinyl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 154062280) has the molecular formula C29H26FN7O2S and a molecular weight of 555.64 g/mol. Its IUPAC name is 5-[[2-[4-[[(5-fluoro-2-isoquinolin-4-yl-4-pyridinyl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[4-[[(5-fluoro-2-isoquinolin-4-yl-4-pyridinyl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 154062280 |
| Molecular Formula | C29H26FN7O2S |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | 5-[[2-[4-[[(5-fluoro-2-isoquinolin-4-yl-4-pyridinyl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccnc(N3CCC(CNCc4cc(-c5cncc6ccccc56)ncc4F)CC3)n2)S1 |
| InChI | InChI=1S/C29H26FN7O2S/c30-24-17-34-25(23-16-32-14-19-3-1-2-4-22(19)23)11-20(24)15-31-13-18-6-9-37(10-7-18)28-33-8-5-21(35-28)12-26-27(38)36-29(39)40-26/h1-5,8,11-12,14,16-18,31H,6-7,9-10,13,15H2,(H,36,38,39) |
| InChIKey | UTMWOSDIICHGKK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|