C24H23FN6O3S — CID 154062338
5-[[2-[4-[[[5-fluoro-2-(furan-2-yl)-4-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 154062338) has the molecular formula C24H23FN6O3S and a molecular weight of 494.55 g/mol. Its IUPAC name is 5-[[2-[4-[[[5-fluoro-2-(furan-2-yl)-4-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[4-[[[5-fluoro-2-(furan-2-yl)-4-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 154062338 |
| Molecular Formula | C24H23FN6O3S |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 5-[[2-[4-[[[5-fluoro-2-(furan-2-yl)-4-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccnc(N3CCC(CNCc4cc(-c5ccco5)ncc4F)CC3)n2)S1 |
| InChI | InChI=1S/C24H23FN6O3S/c25-18-14-28-19(20-2-1-9-34-20)10-16(18)13-26-12-15-4-7-31(8-5-15)23-27-6-3-17(29-23)11-21-22(32)30-24(33)35-21/h1-3,6,9-11,14-15,26H,4-5,7-8,12-13H2,(H,30,32,33) |
| InChIKey | ARXWEJVWJCWBMS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|