About 6-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide
6-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide (PubChem CID 154063306) has the molecular formula C7H7F3N2O
and a molecular weight of 192.14 g/mol. Its IUPAC name is 6-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide |
| PubChem CID | 154063306 |
| Molecular Formula | C7H7F3N2O |
| Molecular Weight | 192.14 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 6-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide |
| SMILES | NC(=O)C1=CC=C(C(F)(F)F)NC1 |
| InChI | InChI=1S/C7H7F3N2O/c8-7(9,10)5-2-1-4(3-12-5)6(11)13/h1-2,12H,3H2,(H2,11,13) |
| InChIKey | YNCWYHDDMHVJFN-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.14 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide?
The IUPAC name of 6-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide (CID 154063306) is 6-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide.
What is the SMILES notation for 6-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide?
The canonical SMILES for 6-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide is NC(=O)C1=CC=C(C(F)(F)F)NC1.
What is the InChIKey of 6-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide?
The InChIKey is YNCWYHDDMHVJFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F3N2O/c8-7(9,10)5-2-1-4(3-12-5)6(11)13/h1-2,12H,3H2,(H2,11,13).
What are the key properties of 6-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide?
6-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide has a molecular weight of 192.14 g/mol, XLogP of 0.45, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(trifluoromethyl)-1,2-dihydropyridine-3-carboxamide is sourced from PubChem (CID 154063306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).