C27H26N6O4S — CID 154064005
5-[[2-[4-[[[2-(1,3-benzodioxol-5-yl)-3-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 154064005) has the molecular formula C27H26N6O4S and a molecular weight of 530.61 g/mol. Its IUPAC name is 5-[[2-[4-[[[2-(1,3-benzodioxol-5-yl)-3-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[4-[[[2-(1,3-benzodioxol-5-yl)-3-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 154064005 |
| Molecular Formula | C27H26N6O4S |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | 5-[[2-[4-[[[2-(1,3-benzodioxol-5-yl)-3-pyridinyl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccnc(N3CCC(CNCc4cccnc4-c4ccc5c(c4)OCO5)CC3)n2)S1 |
| InChI | InChI=1S/C27H26N6O4S/c34-25-23(38-27(35)32-25)13-20-5-9-30-26(31-20)33-10-6-17(7-11-33)14-28-15-19-2-1-8-29-24(19)18-3-4-21-22(12-18)37-16-36-21/h1-5,8-9,12-13,17,28H,6-7,10-11,14-16H2,(H,32,34,35) |
| InChIKey | WUNFCIYCPOTIQW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|