C15H18N4O3 — CID 154064066
ethyl 3-(aminomethylideneamino)-2-cyano-3-[(4-methoxyphenyl)methylamino]prop-2-enoate (PubChem CID 154064066) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is ethyl 3-(aminomethylideneamino)-2-cyano-3-[(4-methoxyphenyl)methylamino]prop-2-enoate.
| Compound Name | ethyl 3-(aminomethylideneamino)-2-cyano-3-[(4-methoxyphenyl)methylamino]prop-2-enoate |
|---|---|
| PubChem CID | 154064066 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | ethyl 3-(aminomethylideneamino)-2-cyano-3-[(4-methoxyphenyl)methylamino]prop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=C(N=CN)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C15H18N4O3/c1-3-22-15(20)13(8-16)14(19-10-17)18-9-11-4-6-12(21-2)7-5-11/h4-7,10,18H,3,9H2,1-2H3,(H2,17,19) |
| InChIKey | GKEDMBHFJPWSHS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|