About thieno[3,4-g][1,2]benzoxazole-6-carboxamide
thieno[3,4-g][1,2]benzoxazole-6-carboxamide (PubChem CID 154065680) has the molecular formula C10H6N2O2S
and a molecular weight of 218.24 g/mol. Its IUPAC name is thieno[3,4-g][1,2]benzoxazole-6-carboxamide.
Molecular Properties
| Compound Name | thieno[3,4-g][1,2]benzoxazole-6-carboxamide |
| PubChem CID | 154065680 |
| Molecular Formula | C10H6N2O2S |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | thieno[3,4-g][1,2]benzoxazole-6-carboxamide |
| SMILES | NC(=O)c1scc2c1ccc1cnoc12 |
| InChI | InChI=1S/C10H6N2O2S/c11-10(13)9-6-2-1-5-3-12-14-8(5)7(6)4-15-9/h1-4H,(H2,11,13) |
| InChIKey | LVHHRIGOGVLRPA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze thieno[3,4-g][1,2]benzoxazole-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,4-g][1,2]benzoxazole-6-carboxamide?
The IUPAC name of thieno[3,4-g][1,2]benzoxazole-6-carboxamide (CID 154065680) is thieno[3,4-g][1,2]benzoxazole-6-carboxamide.
What is the SMILES notation for thieno[3,4-g][1,2]benzoxazole-6-carboxamide?
The canonical SMILES for thieno[3,4-g][1,2]benzoxazole-6-carboxamide is NC(=O)c1scc2c1ccc1cnoc12.
What is the InChIKey of thieno[3,4-g][1,2]benzoxazole-6-carboxamide?
The InChIKey is LVHHRIGOGVLRPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2O2S/c11-10(13)9-6-2-1-5-3-12-14-8(5)7(6)4-15-9/h1-4H,(H2,11,13).
What are the key properties of thieno[3,4-g][1,2]benzoxazole-6-carboxamide?
thieno[3,4-g][1,2]benzoxazole-6-carboxamide has a molecular weight of 218.24 g/mol, XLogP of 2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,4-g][1,2]benzoxazole-6-carboxamide is sourced from PubChem (CID 154065680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).