C22H21F3N6O2 — CID 154065932
N-[3-[[4-[6-(2,2,2-trifluoroethoxy)-3,4-dihydro-1H-isoquinolin-2-yl]-1,3,5-triazin-2-yl]amino]phenyl]acetamide (PubChem CID 154065932) has the molecular formula C22H21F3N6O2 and a molecular weight of 458.44 g/mol. Its IUPAC name is N-[3-[[4-[6-(2,2,2-trifluoroethoxy)-3,4-dihydro-1H-isoquinolin-2-yl]-1,3,5-triazin-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[3-[[4-[6-(2,2,2-trifluoroethoxy)-3,4-dihydro-1H-isoquinolin-2-yl]-1,3,5-triazin-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 154065932 |
| Molecular Formula | C22H21F3N6O2 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | N-[3-[[4-[6-(2,2,2-trifluoroethoxy)-3,4-dihydro-1H-isoquinolin-2-yl]-1,3,5-triazin-2-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2ncnc(N3CCc4cc(OCC(F)(F)F)ccc4C3)n2)c1 |
| InChI | InChI=1S/C22H21F3N6O2/c1-14(32)28-17-3-2-4-18(10-17)29-20-26-13-27-21(30-20)31-8-7-15-9-19(6-5-16(15)11-31)33-12-22(23,24)25/h2-6,9-10,13H,7-8,11-12H2,1H3,(H,28,32)(H,26,27,29,30) |
| InChIKey | HXADMXZXMVSZMI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |