About 5-deuterio-1,3-oxazolidine-2,4-dione
5-deuterio-1,3-oxazolidine-2,4-dione (PubChem CID 154066027) has the molecular formula C3H3NO3
and a molecular weight of 102.07 g/mol. Its IUPAC name is 5-deuterio-1,3-oxazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-deuterio-1,3-oxazolidine-2,4-dione |
| PubChem CID | 154066027 |
| Molecular Formula | C3H3NO3 |
| Molecular Weight | 102.07 g/mol |
| Exact Mass | 102.02 |
| IUPAC Name | 5-deuterio-1,3-oxazolidine-2,4-dione |
| SMILES | [2H]C1OC(=O)NC1=O |
| InChI | InChI=1S/C3H3NO3/c5-2-1-7-3(6)4-2/h1H2,(H,4,5,6)/i1D |
| InChIKey | COWNFYYYZFRNOY-MICDWDOJSA-N |
| XLogP | -0.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.07 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-deuterio-1,3-oxazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-deuterio-1,3-oxazolidine-2,4-dione?
The IUPAC name of 5-deuterio-1,3-oxazolidine-2,4-dione (CID 154066027) is 5-deuterio-1,3-oxazolidine-2,4-dione.
What is the SMILES notation for 5-deuterio-1,3-oxazolidine-2,4-dione?
The canonical SMILES for 5-deuterio-1,3-oxazolidine-2,4-dione is [2H]C1OC(=O)NC1=O.
What is the InChIKey of 5-deuterio-1,3-oxazolidine-2,4-dione?
The InChIKey is COWNFYYYZFRNOY-MICDWDOJSA-N. The full InChI is InChI=1S/C3H3NO3/c5-2-1-7-3(6)4-2/h1H2,(H,4,5,6)/i1D.
What are the key properties of 5-deuterio-1,3-oxazolidine-2,4-dione?
5-deuterio-1,3-oxazolidine-2,4-dione has a molecular weight of 102.07 g/mol, XLogP of -0.75, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-deuterio-1,3-oxazolidine-2,4-dione is sourced from PubChem (CID 154066027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).