C18H24O2 — CID 15406689
2,4,4-trimethyl-3-[(1E,3E,5E)-3-methyl-7-oxoocta-1,3,5-trienyl]cyclohex-2-en-1-one (PubChem CID 15406689) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 2,4,4-trimethyl-3-[(1E,3E,5E)-3-methyl-7-oxoocta-1,3,5-trienyl]cyclohex-2-en-1-one.
| Compound Name | 2,4,4-trimethyl-3-[(1E,3E,5E)-3-methyl-7-oxoocta-1,3,5-trienyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 15406689 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 2,4,4-trimethyl-3-[(1E,3E,5E)-3-methyl-7-oxoocta-1,3,5-trienyl]cyclohex-2-en-1-one |
| SMILES | CC(=O)/C=C/C=C(C)/C=C/C1=C(C)C(=O)CCC1(C)C |
| InChI | InChI=1S/C18H24O2/c1-13(7-6-8-14(2)19)9-10-16-15(3)17(20)11-12-18(16,4)5/h6-10H,11-12H2,1-5H3/b8-6+,10-9+,13-7+ |
| InChIKey | JKAIYKBBQFBZCO-HYPKMOEDSA-N |
| XLogP | 4.34 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|