C23H31ClN4O3Si — CID 154067449
methyl 2-[5-chloro-6-[(3R)-3-methyl-4-[(4-trimethylsilylphenyl)carbamoyl]piperazin-1-yl]-3-pyridinyl]acetate (PubChem CID 154067449) has the molecular formula C23H31ClN4O3Si and a molecular weight of 475.07 g/mol. Its IUPAC name is methyl 2-[5-chloro-6-[(3R)-3-methyl-4-[(4-trimethylsilylphenyl)carbamoyl]piperazin-1-yl]-3-pyridinyl]acetate.
| Compound Name | methyl 2-[5-chloro-6-[(3R)-3-methyl-4-[(4-trimethylsilylphenyl)carbamoyl]piperazin-1-yl]-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 154067449 |
| Molecular Formula | C23H31ClN4O3Si |
| Molecular Weight | 475.07 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | methyl 2-[5-chloro-6-[(3R)-3-methyl-4-[(4-trimethylsilylphenyl)carbamoyl]piperazin-1-yl]-3-pyridinyl]acetate |
| SMILES | COC(=O)Cc1cnc(N2CCN(C(=O)Nc3ccc([Si](C)(C)C)cc3)[C@H](C)C2)c(Cl)c1 |
| InChI | InChI=1S/C23H31ClN4O3Si/c1-16-15-27(22-20(24)12-17(14-25-22)13-21(29)31-2)10-11-28(16)23(30)26-18-6-8-19(9-7-18)32(3,4)5/h6-9,12,14,16H,10-11,13,15H2,1-5H3,(H,26,30)/t16-/m1/s1 |
| InChIKey | HGNFADMXHRBROW-MRXNPFEDSA-N |
| XLogP | 3.74 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.07 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|