C13H18N2 — CID 15406765
2-benzyl-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 15406765) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-benzyl-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | 2-benzyl-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 15406765 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 2-benzyl-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | NC1=NC(Cc2ccccc2)CCCC1 |
| InChI | InChI=1S/C13H18N2/c14-13-9-5-4-8-12(15-13)10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10H2,(H2,14,15) |
| InChIKey | BTHHYBDWOMEVCC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |