C23H22ClN5O — CID 154067833
4-[C-[7-(3-chlorophenyl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]carbonohydrazonoyl]-2,6-dimethylphenol (PubChem CID 154067833) has the molecular formula C23H22ClN5O and a molecular weight of 419.92 g/mol. Its IUPAC name is 4-[C-[7-(3-chlorophenyl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]carbonohydrazonoyl]-2,6-dimethylphenol.
| Compound Name | 4-[C-[7-(3-chlorophenyl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]carbonohydrazonoyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 154067833 |
| Molecular Formula | C23H22ClN5O |
| Molecular Weight | 419.92 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 4-[C-[7-(3-chlorophenyl)-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl]carbonohydrazonoyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(C(=NN)c2ncnc3c2c(C)c(C)n3-c2cccc(Cl)c2)cc(C)c1O |
| InChI | InChI=1S/C23H22ClN5O/c1-12-8-16(9-13(2)22(12)30)20(28-25)21-19-14(3)15(4)29(23(19)27-11-26-21)18-7-5-6-17(24)10-18/h5-11,30H,25H2,1-4H3 |
| InChIKey | JHJFEEWCKTZPCP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.92 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|