C14H13NS — CID 154071173
6,7,8,9-tetrahydro-5H-thioxanthene-3-carbonitrile (PubChem CID 154071173) has the molecular formula C14H13NS and a molecular weight of 227.33 g/mol. Its IUPAC name is 6,7,8,9-tetrahydro-5H-thioxanthene-3-carbonitrile.
| Compound Name | 6,7,8,9-tetrahydro-5H-thioxanthene-3-carbonitrile |
|---|---|
| PubChem CID | 154071173 |
| Molecular Formula | C14H13NS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 6,7,8,9-tetrahydro-5H-thioxanthene-3-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)SC1=C(CCCC1)C2 |
| InChI | InChI=1S/C14H13NS/c15-9-10-5-6-12-8-11-3-1-2-4-13(11)16-14(12)7-10/h5-7H,1-4,8H2 |
| InChIKey | LJCYPMCKRFICKJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |