C15H24N4 — CID 15407131
4,6-dicyclohexyl-1,3,5-triazin-2-amine (PubChem CID 15407131) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is 4,6-dicyclohexyl-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dicyclohexyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 15407131 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 4,6-dicyclohexyl-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(C2CCCCC2)nc(C2CCCCC2)n1 |
| InChI | InChI=1S/C15H24N4/c16-15-18-13(11-7-3-1-4-8-11)17-14(19-15)12-9-5-2-6-10-12/h11-12H,1-10H2,(H2,16,17,18,19) |
| InChIKey | ZUSJOXJMOWKSDJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |