C29H20Cl3FN2O6 — CID 154071902
ethyl (E)-4-[3-[[1-(3-chloro-2-fluorophenyl)-2-(3,4-dichlorophenyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]anilino]-4-oxobut-2-enoate (PubChem CID 154071902) has the molecular formula C29H20Cl3FN2O6 and a molecular weight of 617.84 g/mol. Its IUPAC name is ethyl (E)-4-[3-[[1-(3-chloro-2-fluorophenyl)-2-(3,4-dichlorophenyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]anilino]-4-oxobut-2-enoate.
| Compound Name | ethyl (E)-4-[3-[[1-(3-chloro-2-fluorophenyl)-2-(3,4-dichlorophenyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]anilino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 154071902 |
| Molecular Formula | C29H20Cl3FN2O6 |
| Molecular Weight | 617.84 g/mol |
| Exact Mass | 616.04 |
| IUPAC Name | ethyl (E)-4-[3-[[1-(3-chloro-2-fluorophenyl)-2-(3,4-dichlorophenyl)-4,5-dioxopyrrolidin-3-ylidene]-hydroxymethyl]anilino]-4-oxobut-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)Nc1cccc(C(O)=C2C(=O)C(=O)N(c3cccc(Cl)c3F)C2c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C29H20Cl3FN2O6/c1-2-41-23(37)12-11-22(36)34-17-6-3-5-16(13-17)27(38)24-26(15-9-10-18(30)20(32)14-15)35(29(40)28(24)39)21-8-4-7-19(31)25(21)33/h3-14,26,38H,2H2,1H3,(H,34,36)/b12-11+,27-24? |
| InChIKey | JIEKBFOWNZKOTH-MKZWXWGASA-N |
| XLogP | 6.47 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.84 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|