C18H22F3NO4S — CID 154072011
2-methylsulfanylethyl (2R,4S)-4-acetyloxy-2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 154072011) has the molecular formula C18H22F3NO4S and a molecular weight of 405.44 g/mol. Its IUPAC name is 2-methylsulfanylethyl (2R,4S)-4-acetyloxy-2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | 2-methylsulfanylethyl (2R,4S)-4-acetyloxy-2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 154072011 |
| Molecular Formula | C18H22F3NO4S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 2-methylsulfanylethyl (2R,4S)-4-acetyloxy-2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | CC[C@@H]1C[C@H](OC(C)=O)c2cc(C(F)(F)F)ccc2N1C(=O)OCCSC |
| InChI | InChI=1S/C18H22F3NO4S/c1-4-13-10-16(26-11(2)23)14-9-12(18(19,20)21)5-6-15(14)22(13)17(24)25-7-8-27-3/h5-6,9,13,16H,4,7-8,10H2,1-3H3/t13-,16+/m1/s1 |
| InChIKey | DWLYXWVCTXLGGU-CJNGLKHVSA-N |
| XLogP | 4.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|