C9H16F5NS — CID 154072273
4-(4,4,5,5,5-pentafluoropentylsulfanyl)butan-2-amine (PubChem CID 154072273) has the molecular formula C9H16F5NS and a molecular weight of 265.29 g/mol. Its IUPAC name is 4-(4,4,5,5,5-pentafluoropentylsulfanyl)butan-2-amine.
| Compound Name | 4-(4,4,5,5,5-pentafluoropentylsulfanyl)butan-2-amine |
|---|---|
| PubChem CID | 154072273 |
| Molecular Formula | C9H16F5NS |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 4-(4,4,5,5,5-pentafluoropentylsulfanyl)butan-2-amine |
| SMILES | CC(N)CCSCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H16F5NS/c1-7(15)3-6-16-5-2-4-8(10,11)9(12,13)14/h7H,2-6,15H2,1H3 |
| InChIKey | UYGNYUYOFCNVRK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|