C11H18N2O — CID 154072972
4-(2-methoxyphenyl)butane-1,3-diamine (PubChem CID 154072972) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)butane-1,3-diamine.
| Compound Name | 4-(2-methoxyphenyl)butane-1,3-diamine |
|---|---|
| PubChem CID | 154072972 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 4-(2-methoxyphenyl)butane-1,3-diamine |
| SMILES | COc1ccccc1CC(N)CCN |
| InChI | InChI=1S/C11H18N2O/c1-14-11-5-3-2-4-9(11)8-10(13)6-7-12/h2-5,10H,6-8,12-13H2,1H3 |
| InChIKey | ZOCDVFFBKZEJMY-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |