About 3-(3-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazole-5-carboxylic acid
3-(3-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazole-5-carboxylic acid (PubChem CID 154075312) has the molecular formula C14H9BrCl2N2O2S
and a molecular weight of 420.12 g/mol. Its IUPAC name is 3-(3-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-(3-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazole-5-carboxylic acid |
| PubChem CID | 154075312 |
| Molecular Formula | C14H9BrCl2N2O2S |
| Molecular Weight | 420.12 g/mol |
| Exact Mass | 417.89 |
| IUPAC Name | 3-(3-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazole-5-carboxylic acid |
| SMILES | O=C(O)C1=NN(c2ccc(Cl)cc2Cl)C(c2sccc2Br)C1 |
| InChI | InChI=1S/C14H9BrCl2N2O2S/c15-8-3-4-22-13(8)12-6-10(14(20)21)18-19(12)11-2-1-7(16)5-9(11)17/h1-5,12H,6H2,(H,20,21) |
| InChIKey | KDYBOIXDPVXGFQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.12 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazole-5-carboxylic acid?
The IUPAC name of 3-(3-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazole-5-carboxylic acid (CID 154075312) is 3-(3-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazole-5-carboxylic acid.
What is the SMILES notation for 3-(3-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazole-5-carboxylic acid?
The canonical SMILES for 3-(3-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazole-5-carboxylic acid is O=C(O)C1=NN(c2ccc(Cl)cc2Cl)C(c2sccc2Br)C1.
What is the InChIKey of 3-(3-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazole-5-carboxylic acid?
The InChIKey is KDYBOIXDPVXGFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9BrCl2N2O2S/c15-8-3-4-22-13(8)12-6-10(14(20)21)18-19(12)11-2-1-7(16)5-9(11)17/h1-5,12H,6H2,(H,20,21).
What are the key properties of 3-(3-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazole-5-carboxylic acid?
3-(3-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazole-5-carboxylic acid has a molecular weight of 420.12 g/mol, XLogP of 5.21, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromothiophen-2-yl)-2-(2,4-dichlorophenyl)-3,4-dihydropyrazole-5-carboxylic acid is sourced from PubChem (CID 154075312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).