C17H17Cl2N5 — CID 154076062
2-chloro-7-[(4-chlorophenyl)methyl]-N-(1-cyclopropylethyl)purin-6-amine (PubChem CID 154076062) has the molecular formula C17H17Cl2N5 and a molecular weight of 362.26 g/mol. Its IUPAC name is 2-chloro-7-[(4-chlorophenyl)methyl]-N-(1-cyclopropylethyl)purin-6-amine.
| Compound Name | 2-chloro-7-[(4-chlorophenyl)methyl]-N-(1-cyclopropylethyl)purin-6-amine |
|---|---|
| PubChem CID | 154076062 |
| Molecular Formula | C17H17Cl2N5 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 2-chloro-7-[(4-chlorophenyl)methyl]-N-(1-cyclopropylethyl)purin-6-amine |
| SMILES | CC(Nc1nc(Cl)nc2ncn(Cc3ccc(Cl)cc3)c12)C1CC1 |
| InChI | InChI=1S/C17H17Cl2N5/c1-10(12-4-5-12)21-16-14-15(22-17(19)23-16)20-9-24(14)8-11-2-6-13(18)7-3-11/h2-3,6-7,9-10,12H,4-5,8H2,1H3,(H,21,22,23) |
| InChIKey | LBILUDNRLUPKQG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |