About 1-N,4-N-bis[4-(ethylamino)butyl]cyclohexane-1,4-diamine
1-N,4-N-bis[4-(ethylamino)butyl]cyclohexane-1,4-diamine (PubChem CID 15407935) has the molecular formula C18H40N4
and a molecular weight of 312.55 g/mol. Its IUPAC name is 1-N,4-N-bis[4-(ethylamino)butyl]cyclohexane-1,4-diamine.
Molecular Properties
| Compound Name | 1-N,4-N-bis[4-(ethylamino)butyl]cyclohexane-1,4-diamine |
| PubChem CID | 15407935 |
| Molecular Formula | C18H40N4 |
| Molecular Weight | 312.55 g/mol |
| Exact Mass | 312.33 |
| IUPAC Name | 1-N,4-N-bis[4-(ethylamino)butyl]cyclohexane-1,4-diamine |
| SMILES | CCNCCCCNC1CCC(NCCCCNCC)CC1 |
| InChI | InChI=1S/C18H40N4/c1-3-19-13-5-7-15-21-17-9-11-18(12-10-17)22-16-8-6-14-20-4-2/h17-22H,3-16H2,1-2H3 |
| InChIKey | YKGBMXAHALDFPL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.55 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-N,4-N-bis[4-(ethylamino)butyl]cyclohexane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,4-N-bis[4-(ethylamino)butyl]cyclohexane-1,4-diamine?
The IUPAC name of 1-N,4-N-bis[4-(ethylamino)butyl]cyclohexane-1,4-diamine (CID 15407935) is 1-N,4-N-bis[4-(ethylamino)butyl]cyclohexane-1,4-diamine.
What is the SMILES notation for 1-N,4-N-bis[4-(ethylamino)butyl]cyclohexane-1,4-diamine?
The canonical SMILES for 1-N,4-N-bis[4-(ethylamino)butyl]cyclohexane-1,4-diamine is CCNCCCCNC1CCC(NCCCCNCC)CC1.
What is the InChIKey of 1-N,4-N-bis[4-(ethylamino)butyl]cyclohexane-1,4-diamine?
The InChIKey is YKGBMXAHALDFPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H40N4/c1-3-19-13-5-7-15-21-17-9-11-18(12-10-17)22-16-8-6-14-20-4-2/h17-22H,3-16H2,1-2H3.
What are the key properties of 1-N,4-N-bis[4-(ethylamino)butyl]cyclohexane-1,4-diamine?
1-N,4-N-bis[4-(ethylamino)butyl]cyclohexane-1,4-diamine has a molecular weight of 312.55 g/mol, XLogP of 2.26, 14 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,4-N-bis[4-(ethylamino)butyl]cyclohexane-1,4-diamine is sourced from PubChem (CID 15407935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).