About hafnium;2-methyl-4-phenyl-1H-inden-1-ide
hafnium;2-methyl-4-phenyl-1H-inden-1-ide (PubChem CID 154081664) has the molecular formula C16H13Hf-
and a molecular weight of 383.77 g/mol. Its IUPAC name is hafnium;2-methyl-4-phenyl-1H-inden-1-ide.
Molecular Properties
| Compound Name | hafnium;2-methyl-4-phenyl-1H-inden-1-ide |
| PubChem CID | 154081664 |
| Molecular Formula | C16H13Hf- |
| Molecular Weight | 383.77 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | hafnium;2-methyl-4-phenyl-1H-inden-1-ide |
| SMILES | Cc1cc2c(-c3ccccc3)cccc2[cH-]1.[Hf] |
| InChI | InChI=1S/C16H13.Hf/c1-12-10-14-8-5-9-15(16(14)11-12)13-6-3-2-4-7-13;/h2-11H,1H3;/q-1; |
| InChIKey | NDXQGARGBAFIIT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.77 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze hafnium;2-methyl-4-phenyl-1H-inden-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hafnium;2-methyl-4-phenyl-1H-inden-1-ide?
The IUPAC name of hafnium;2-methyl-4-phenyl-1H-inden-1-ide (CID 154081664) is hafnium;2-methyl-4-phenyl-1H-inden-1-ide.
What is the SMILES notation for hafnium;2-methyl-4-phenyl-1H-inden-1-ide?
The canonical SMILES for hafnium;2-methyl-4-phenyl-1H-inden-1-ide is Cc1cc2c(-c3ccccc3)cccc2[cH-]1.[Hf].
What is the InChIKey of hafnium;2-methyl-4-phenyl-1H-inden-1-ide?
The InChIKey is NDXQGARGBAFIIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13.Hf/c1-12-10-14-8-5-9-15(16(14)11-12)13-6-3-2-4-7-13;/h2-11H,1H3;/q-1;.
What are the key properties of hafnium;2-methyl-4-phenyl-1H-inden-1-ide?
hafnium;2-methyl-4-phenyl-1H-inden-1-ide has a molecular weight of 383.77 g/mol, XLogP of 4.53, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hafnium;2-methyl-4-phenyl-1H-inden-1-ide is sourced from PubChem (CID 154081664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).