C21H28O4 — CID 154083095
(8S,10S,13S,14S,17S)-17-acetyl-4,11-dihydroxy-10,13-dimethyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 154083095) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is (8S,10S,13S,14S,17S)-17-acetyl-4,11-dihydroxy-10,13-dimethyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10S,13S,14S,17S)-17-acetyl-4,11-dihydroxy-10,13-dimethyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 154083095 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (8S,10S,13S,14S,17S)-17-acetyl-4,11-dihydroxy-10,13-dimethyl-1,2,6,7,8,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=C(O)C(=O)CC[C@]4(C)C3=C(O)C[C@]12C |
| InChI | InChI=1S/C21H28O4/c1-11(22)13-6-7-14-12-4-5-15-19(25)16(23)8-9-20(15,2)18(12)17(24)10-21(13,14)3/h12-14,24-25H,4-10H2,1-3H3/t12-,13+,14-,20-,21+/m0/s1 |
| InChIKey | ZNIFVRCDHYYMNN-QZOYHBKXSA-N |
| XLogP | 4.41 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |