About N-(4,4-diethoxybut-1-enylsilyl)-N-ethylethanamine
N-(4,4-diethoxybut-1-enylsilyl)-N-ethylethanamine (PubChem CID 154083246) has the molecular formula C12H27NO2Si
and a molecular weight of 245.44 g/mol. Its IUPAC name is N-(4,4-diethoxybut-1-enylsilyl)-N-ethylethanamine.
Molecular Properties
| Compound Name | N-(4,4-diethoxybut-1-enylsilyl)-N-ethylethanamine |
| PubChem CID | 154083246 |
| Molecular Formula | C12H27NO2Si |
| Molecular Weight | 245.44 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | N-(4,4-diethoxybut-1-enylsilyl)-N-ethylethanamine |
| SMILES | CCOC(CC=C[SiH2]N(CC)CC)OCC |
| InChI | InChI=1S/C12H27NO2Si/c1-5-13(6-2)16-11-9-10-12(14-7-3)15-8-4/h9,11-12H,5-8,10,16H2,1-4H3 |
| InChIKey | NWUBOXRXWSLFOX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(4,4-diethoxybut-1-enylsilyl)-N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-diethoxybut-1-enylsilyl)-N-ethylethanamine?
The IUPAC name of N-(4,4-diethoxybut-1-enylsilyl)-N-ethylethanamine (CID 154083246) is N-(4,4-diethoxybut-1-enylsilyl)-N-ethylethanamine.
What is the SMILES notation for N-(4,4-diethoxybut-1-enylsilyl)-N-ethylethanamine?
The canonical SMILES for N-(4,4-diethoxybut-1-enylsilyl)-N-ethylethanamine is CCOC(CC=C[SiH2]N(CC)CC)OCC.
What is the InChIKey of N-(4,4-diethoxybut-1-enylsilyl)-N-ethylethanamine?
The InChIKey is NWUBOXRXWSLFOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27NO2Si/c1-5-13(6-2)16-11-9-10-12(14-7-3)15-8-4/h9,11-12H,5-8,10,16H2,1-4H3.
What are the key properties of N-(4,4-diethoxybut-1-enylsilyl)-N-ethylethanamine?
N-(4,4-diethoxybut-1-enylsilyl)-N-ethylethanamine has a molecular weight of 245.44 g/mol, XLogP of 1.71, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-diethoxybut-1-enylsilyl)-N-ethylethanamine is sourced from PubChem (CID 154083246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).