About 6-phenyloxathiane
6-phenyloxathiane (PubChem CID 154084177) has the molecular formula C10H12OS
and a molecular weight of 180.27 g/mol. Its IUPAC name is 6-phenyloxathiane.
Molecular Properties
| Compound Name | 6-phenyloxathiane |
| PubChem CID | 154084177 |
| Molecular Formula | C10H12OS |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 6-phenyloxathiane |
| SMILES | c1ccc(C2CCCSO2)cc1 |
| InChI | InChI=1S/C10H12OS/c1-2-5-9(6-3-1)10-7-4-8-12-11-10/h1-3,5-6,10H,4,7-8H2 |
| InChIKey | BFBRFYNAGNXRSY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-phenyloxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyloxathiane?
The IUPAC name of 6-phenyloxathiane (CID 154084177) is 6-phenyloxathiane.
What is the SMILES notation for 6-phenyloxathiane?
The canonical SMILES for 6-phenyloxathiane is c1ccc(C2CCCSO2)cc1.
What is the InChIKey of 6-phenyloxathiane?
The InChIKey is BFBRFYNAGNXRSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12OS/c1-2-5-9(6-3-1)10-7-4-8-12-11-10/h1-3,5-6,10H,4,7-8H2.
What are the key properties of 6-phenyloxathiane?
6-phenyloxathiane has a molecular weight of 180.27 g/mol, XLogP of 3.19, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyloxathiane is sourced from PubChem (CID 154084177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).