About 4-N-nitrosobenzene-1,4-dicarboxamide
4-N-nitrosobenzene-1,4-dicarboxamide (PubChem CID 154084422) has the molecular formula C8H7N3O3
and a molecular weight of 193.16 g/mol. Its IUPAC name is 4-N-nitrosobenzene-1,4-dicarboxamide.
Molecular Properties
| Compound Name | 4-N-nitrosobenzene-1,4-dicarboxamide |
| PubChem CID | 154084422 |
| Molecular Formula | C8H7N3O3 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 4-N-nitrosobenzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(=O)NN=O)cc1 |
| InChI | InChI=1S/C8H7N3O3/c9-7(12)5-1-3-6(4-2-5)8(13)10-11-14/h1-4H,(H2,9,12)(H,10,13,14) |
| InChIKey | LZTGLHIFEDXJQC-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-N-nitrosobenzene-1,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-nitrosobenzene-1,4-dicarboxamide?
The IUPAC name of 4-N-nitrosobenzene-1,4-dicarboxamide (CID 154084422) is 4-N-nitrosobenzene-1,4-dicarboxamide.
What is the SMILES notation for 4-N-nitrosobenzene-1,4-dicarboxamide?
The canonical SMILES for 4-N-nitrosobenzene-1,4-dicarboxamide is NC(=O)c1ccc(C(=O)NN=O)cc1.
What is the InChIKey of 4-N-nitrosobenzene-1,4-dicarboxamide?
The InChIKey is LZTGLHIFEDXJQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O3/c9-7(12)5-1-3-6(4-2-5)8(13)10-11-14/h1-4H,(H2,9,12)(H,10,13,14).
What are the key properties of 4-N-nitrosobenzene-1,4-dicarboxamide?
4-N-nitrosobenzene-1,4-dicarboxamide has a molecular weight of 193.16 g/mol, XLogP of 0.20, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-nitrosobenzene-1,4-dicarboxamide is sourced from PubChem (CID 154084422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).